* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10724085 |
English Synonyms: | SELENA SEL10724085 |
MDL Number.: | MFCD17118815 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCC1CCCCC1n2c(nnn2)CNCC |
InChi: | InChI=1S/C12H23N5/c1-3-10-7-5-6-8-11(10)17-12(9-13-4-2)14-15-16-17/h10-11,13H,3-9H2,1-2H3 |
InChiKey: | InChIKey=BONLSNVACQGDQF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.