Molecular Structure:
CCD No.:CCD03385446
SELENA SEL10724123
Formula:C13 H19 N5 O
MolWeight:261.327
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10724123 |
| English Synonyms： | SELENA SEL10724123 |
| MDL Number.： | MFCD17118853 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | CC(C)NCc1nnnn1c2ccccc2COC |
| InChi： | InChI=1S/C13H19N5O/c1-10(2)14-8-13-15-16-17-18(13)12-7-5-4-6-11(12)9-19-3/h4-7,10,14H,8-9H2,1-3H3 |
| InChiKey： | InChIKey=ZLATUMRQIFKHTG-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
