Molecular Structure:
CCD No.:CCD03385451
SELENA SEL10724128
Formula:C12 H14 Br N5 O
MolWeight:324.181
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10724128 |
| English Synonyms： | SELENA SEL10724128 |
| MDL Number.： | MFCD17118858 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | COc1ccc(cc1n2c(nnn2)CNC3CC3)Br |
| InChi： | InChI=1S/C12H14BrN5O/c1-19-11-5-2-8(13)6-10(11)18-12(15-16-17-18)7-14-9-3-4-9/h2,5-6,9,14H,3-4,7H2,1H3 |
| InChiKey： | InChIKey=DRUABRKOFBTSAC-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
