* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10724132 |
English Synonyms: | SELENA SEL10724132 |
MDL Number.: | MFCD17118862 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cc2c(cc1NCc3cnc[nH]3)OCCCO2 |
InChi: | InChI=1S/C13H15N3O2/c1-4-17-12-3-2-10(6-13(12)18-5-1)15-8-11-7-14-9-16-11/h2-3,6-7,9,15H,1,4-5,8H2,(H,14,16) |
InChiKey: | InChIKey=ZJFWCYSEBSXTHV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.