Molecular Structure:
CCD No.:CCD03385683
SELENA SEL10724376
Formula:C13 H16 N4 O2
MolWeight:260.295
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10724376 |
| English Synonyms： | SELENA SEL10724376 |
| MDL Number.： | MFCD17119105 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | COCCn1cc(ccc1=O)NCc2cnccn2 |
| InChi： | InChI=1S/C13H16N4O2/c1-19-7-6-17-10-11(2-3-13(17)18)16-9-12-8-14-4-5-15-12/h2-5,8,10,16H,6-7,9H2,1H3 |
| InChiKey： | InChIKey=ZTMRCCFKSJPZHZ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
