* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10724412 |
English Synonyms: | SELENA SEL10724412 |
MDL Number.: | MFCD17119141 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CNC(=O)Cn1cc(cn1)NCc2cnccn2 |
InChi: | InChI=1S/C11H14N6O/c1-12-11(18)8-17-7-10(6-16-17)15-5-9-4-13-2-3-14-9/h2-4,6-7,15H,5,8H2,1H3,(H,12,18) |
InChiKey: | InChIKey=KPGWNNIGESNNSF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.