* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10724638 |
English Synonyms: | SELENA SEL10724638 |
MDL Number.: | MFCD17119366 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CN(CCCNCc1cncs1)c2ccccc2 |
InChi: | InChI=1S/C14H19N3S/c1-17(13-6-3-2-4-7-13)9-5-8-15-10-14-11-16-12-18-14/h2-4,6-7,11-12,15H,5,8-10H2,1H3 |
InChiKey: | InChIKey=LDULGVWCIPIGPI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.