* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10725190 |
English Synonyms: | SELENA SEL10725190 |
MDL Number.: | MFCD17119914 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | Cc1c([nH]cn1)CNC2CCN(CC2)S(=O)(=O)C |
InChi: | InChI=1S/C11H20N4O2S/c1-9-11(14-8-13-9)7-12-10-3-5-15(6-4-10)18(2,16)17/h8,10,12H,3-7H2,1-2H3,(H,13,14) |
InChiKey: | InChIKey=CSWPOHSFKDZDKR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.