* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10725233 |
English Synonyms: | SELENA SEL10725233 |
MDL Number.: | MFCD17119957 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | Cc1c2cc(cnc2n(n1)C)NCc3c(nc[nH]3)C |
InChi: | InChI=1S/C13H16N6/c1-8-11-4-10(5-15-13(11)19(3)18-8)14-6-12-9(2)16-7-17-12/h4-5,7,14H,6H2,1-3H3,(H,16,17) |
InChiKey: | InChIKey=LVZBFHQZMSVZSM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.