Molecular Structure:
CCD No.:CCD03387276
SELENA SEL10725998
Formula:C14 H19 N3 O S
MolWeight:277.39
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10725998 |
| English Synonyms： | SELENA SEL10725998 |
| MDL Number.： | MFCD17120713 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | Cc1c(c(nc(n1)c2ccsc2)C)CNCCOC |
| InChi： | InChI=1S/C14H19N3OS/c1-10-13(8-15-5-6-18-3)11(2)17-14(16-10)12-4-7-19-9-12/h4,7,9,15H,5-6,8H2,1-3H3 |
| InChiKey： | InChIKey=CAQKRLHOOIAESD-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
