Molecular Structure:
CCD No.:CCD03387449
SELENA SEL10726183
Formula:C10 H9 F3 N4
MolWeight:242.203
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10726183 |
| English Synonyms： | SELENA SEL10726183 |
| MDL Number.： | MFCD17120891 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | Cn1cc(nn1)CNc2ccc(c(c2F)F)F |
| InChi： | InChI=1S/C10H9F3N4/c1-17-5-6(15-16-17)4-14-8-3-2-7(11)9(12)10(8)13/h2-3,5,14H,4H2,1H3 |
| InChiKey： | InChIKey=OUNBHRLLNPEGFO-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
