Molecular Structure:
CCD No.:CCD03387549
SELENA SEL10726284
Formula:C13 H22 N6
MolWeight:262.359
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10726284 |
| English Synonyms： | SELENA SEL10726284 |
| MDL Number.： | MFCD17120992 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | CC(C)(C)C(Cn1ccnc1)NCc2cn(nn2)C |
| InChi： | InChI=1S/C13H22N6/c1-13(2,3)12(9-19-6-5-14-10-19)15-7-11-8-18(4)17-16-11/h5-6,8,10,12,15H,7,9H2,1-4H3 |
| InChiKey： | InChIKey=PJJFJNBKXPPEQS-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
