* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10726302 |
English Synonyms: | SELENA SEL10726302 |
MDL Number.: | MFCD17121010 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | CNC(=O)Cn1cc(cn1)NCc2cn(nn2)C |
InChi: | InChI=1S/C10H15N7O/c1-11-10(18)7-17-6-8(4-13-17)12-3-9-5-16(2)15-14-9/h4-6,12H,3,7H2,1-2H3,(H,11,18) |
InChiKey: | InChIKey=WGZANEWOCRDGDZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.