Molecular Structure:
CCD No.:CCD03387569
SELENA SEL10726304
Formula:C13 H17 N5 O
MolWeight:259.311
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10726304 |
| English Synonyms： | SELENA SEL10726304 |
| MDL Number.： | MFCD17121012 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | Cn1cc(nn1)CNCC(=O)NCc2ccccc2 |
| InChi： | InChI=1S/C13H17N5O/c1-18-10-12(16-17-18)8-14-9-13(19)15-7-11-5-3-2-4-6-11/h2-6,10,14H,7-9H2,1H3,(H,15,19) |
| InChiKey： | InChIKey=ZQHNZDKETAQHHV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
