Molecular Structure:
CCD No.:CCD03388281
SELENA SEL10727023
Formula:C15 H16 N2 O S
MolWeight:272.37
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10727023 |
| English Synonyms： | SELENA SEL10727023 |
| MDL Number.： | MFCD17121729 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | c1ccc2c(c1)CCN2c3nc4c(s3)C(CCC4)O |
| InChi： | InChI=1S/C15H16N2OS/c18-13-7-3-5-11-14(13)19-15(16-11)17-9-8-10-4-1-2-6-12(10)17/h1-2,4,6,13,18H,3,5,7-9H2 |
| InChiKey： | InChIKey=WAXNFXLJDZFIQK-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
