* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10727450 |
English Synonyms: | SELENA SEL10727450 |
MDL Number.: | MFCD17122153 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1c(cc(cc1F)F)OCCNC2CCS(=O)(=O)C2 |
InChi: | InChI=1S/C12H15F2NO3S/c13-9-5-10(14)7-12(6-9)18-3-2-15-11-1-4-19(16,17)8-11/h5-7,11,15H,1-4,8H2 |
InChiKey: | InChIKey=XADSIJWCANKZNO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.