Molecular Structure:
CCD No.:CCD03388683
SELENA SEL10727454
Formula:C14 H15 F2 N O S
MolWeight:283.341
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10727454 |
| English Synonyms： | SELENA SEL10727454 |
| MDL Number.： | MFCD17122157 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | c1cscc1CCNCCOc2cc(cc(c2)F)F |
| InChi： | InChI=1S/C14H15F2NOS/c15-12-7-13(16)9-14(8-12)18-5-4-17-3-1-11-2-6-19-10-11/h2,6-10,17H,1,3-5H2 |
| InChiKey： | InChIKey=QNNFXKPQSJEBTF-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
