Molecular Structure:
CCD No.:CCD03388965
SELENA SEL10727741
Formula:C14 H17 N O S
MolWeight:247.36
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10727741 |
| English Synonyms： | SELENA SEL10727741 |
| MDL Number.： | MFCD17122444 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | Cc1ccccc1CSC(CN)c2ccco2 |
| InChi： | InChI=1S/C14H17NOS/c1-11-5-2-3-6-12(11)10-17-14(9-15)13-7-4-8-16-13/h2-8,14H,9-10,15H2,1H3 |
| InChiKey： | InChIKey=IEXUGWZKABNQII-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
