Molecular Structure:
CCD No.:CCD03389220
SELENA SEL10728013
Formula:C14 H20 N2 O2 S
MolWeight:280.39
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10728013 |
| English Synonyms： | SELENA SEL10728013 |
| MDL Number.： | MFCD17122716 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | CCCc1c(sc(n1)N2CCOC3C2CCC3)C=O |
| InChi： | InChI=1S/C14H20N2O2S/c1-2-4-10-13(9-17)19-14(15-10)16-7-8-18-12-6-3-5-11(12)16/h9,11-12H,2-8H2,1H3 |
| InChiKey： | InChIKey=YIJUYYZTXYKSAO-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
