Molecular Structure:
CCD No.:CCD03389720
SELENA SEL10728542
Formula:C13 H21 N5 S
MolWeight:279.41
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10728542 |
| English Synonyms： | SELENA SEL10728542 |
| MDL Number.： | MFCD17123242 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CCCc1c(sc(n1)N(C)Cc2cnn(c2)C)CN |
| InChi： | InChI=1S/C13H21N5S/c1-4-5-11-12(6-14)19-13(16-11)17(2)8-10-7-15-18(3)9-10/h7,9H,4-6,8,14H2,1-3H3 |
| InChiKey： | InChIKey=HNWRXYJDCMIUBX-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
