Molecular Structure:
CCD No.:CCD03389967
SELENA SEL10728791
Formula:C16 H17 N3
MolWeight:251.331
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10728791 |
| English Synonyms： | SELENA SEL10728791 |
| MDL Number.： | MFCD17123490 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | c1ccc(cc1)C(CCN)n2c3ccccc3cn2 |
| InChi： | InChI=1S/C16H17N3/c17-11-10-16(13-6-2-1-3-7-13)19-15-9-5-4-8-14(15)12-18-19/h1-9,12,16H,10-11,17H2 |
| InChiKey： | InChIKey=LRCDGXBVOPVTEL-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
