* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10728821 |
| English Synonyms: | SELENA SEL10728821 |
| MDL Number.: | MFCD17123513 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cn1cnnc1SC(CCN)c2ccccc2 |
| InChi: | InChI=1S/C12H16N4S/c1-16-9-14-15-12(16)17-11(7-8-13)10-5-3-2-4-6-10/h2-6,9,11H,7-8,13H2,1H3 |
| InChiKey: | InChIKey=FMBYBLMCBQRCCL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.