Molecular Structure:
CCD No.:CCD03390242
SELENA SEL10729261
Formula:C13 H22 N4 O
MolWeight:250.344
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10729261 |
| English Synonyms： | SELENA SEL10729261 |
| MDL Number.： | MFCD17123906 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | CCC(C)N1CCN(CC1)C(=O)c2cc(c[nH]2)N |
| InChi： | InChI=1S/C13H22N4O/c1-3-10(2)16-4-6-17(7-5-16)13(18)12-8-11(14)9-15-12/h8-10,15H,3-7,14H2,1-2H3 |
| InChiKey： | InChIKey=OBYLUBNYLJVPEP-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
