Molecular Structure:
CCD No.:CCD03390477
SELENA SEL10729510
Formula:C12 H23 N5 S
MolWeight:269.415
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10729510 |
| English Synonyms： | SELENA SEL10729510 |
| MDL Number.： | MFCD17124149 |
| H bond acceptor： | 5 |
| H bond donor： | 0 |
| Smile： | CCn1c(nnc1S)N2CCN(CC2)CC(C)C |
| InChi： | InChI=1S/C12H23N5S/c1-4-17-11(13-14-12(17)18)16-7-5-15(6-8-16)9-10(2)3/h10H,4-9H2,1-3H3,(H,14,18) |
| InChiKey： | InChIKey=BBYAWVFUYUCGKF-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
