Molecular Structure:
CCD No.:CCD03390783
SELENA SEL10729834
Formula:C13 H25 N3 O2
MolWeight:255.359
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10729834 |
| English Synonyms： | SELENA SEL10729834 |
| MDL Number.： | MFCD17124473 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CC1CC(CCC1N)C(=O)N(C)CC(=O)N(C)C |
| InChi： | InChI=1S/C13H25N3O2/c1-9-7-10(5-6-11(9)14)13(18)16(4)8-12(17)15(2)3/h9-11H,5-8,14H2,1-4H3 |
| InChiKey： | InChIKey=WEKLUGIXPJEXHY-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
