Molecular Structure:
CCD No.:CCD03391003
SELENA SEL10730054
Formula:C12 H23 N3 O2
MolWeight:241.333
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10730054 |
| English Synonyms： | SELENA SEL10730054 |
| MDL Number.： | MFCD17124693 |
| H bond acceptor： | 5 |
| H bond donor： | 3 |
| Smile： | CC1CCC(CC1N)C(=O)NC(C)(C)C(=O)N |
| InChi： | InChI=1S/C12H23N3O2/c1-7-4-5-8(6-9(7)13)10(16)15-12(2,3)11(14)17/h7-9H,4-6,13H2,1-3H3,(H2,14,17)(H,15,16) |
| InChiKey： | InChIKey=XUEFLFYOVDGRPQ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
