Molecular Structure:
CCD No.:CCD03391525
SELENA SEL10730601
Formula:C9 H10 N6 O3 S
MolWeight:282.283
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10730601 |
| English Synonyms： | SELENA SEL10730601 |
| MDL Number.： | MFCD17125239 |
| H bond acceptor： | 9 |
| H bond donor： | 3 |
| Smile： | CS(=O)(=O)c1ccc(cn1)NC(=O)c2nc([nH]n2)N |
| InChi： | InChI=1S/C9H10N6O3S/c1-19(17,18)6-3-2-5(4-11-6)12-8(16)7-13-9(10)15-14-7/h2-4H,1H3,(H,12,16)(H3,10,13,14,15) |
| InChiKey： | InChIKey=MLJPWPDUGONIHN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
