* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10730614 |
English Synonyms: | SELENA SEL10730614 |
MDL Number.: | MFCD17125252 |
H bond acceptor: | 10 |
H bond donor: | 4 |
Smile: | c1c(cn(n1)CC(=O)N)NC(=O)c2nc([nH]n2)N |
InChi: | InChI=1S/C8H10N8O2/c9-5(17)3-16-2-4(1-11-16)12-7(18)6-13-8(10)15-14-6/h1-2H,3H2,(H2,9,17)(H,12,18)(H3,10,13,14,15) |
InChiKey: | InChIKey=WJTVTRIQEZEUJI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.