* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10730623 |
English Synonyms: | SELENA SEL10730623 |
MDL Number.: | MFCD17125260 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | c1cc(ccc1CC(=O)N)NC(=O)c2nc([nH]n2)N |
InChi: | InChI=1S/C11H12N6O2/c12-8(18)5-6-1-3-7(4-2-6)14-10(19)9-15-11(13)17-16-9/h1-4H,5H2,(H2,12,18)(H,14,19)(H3,13,15,16,17) |
InChiKey: | InChIKey=OCDKAITXFAXDBK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.