* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10730628 |
| English Synonyms: | SELENA SEL10730628 |
| MDL Number.: | MFCD17125265 |
| H bond acceptor: | 9 |
| H bond donor: | 4 |
| Smile: | C1CN(CCC1NC(=O)c2nc([nH]n2)N)CC(=O)N |
| InChi: | InChI=1S/C10H17N7O2/c11-7(18)5-17-3-1-6(2-4-17)13-9(19)8-14-10(12)16-15-8/h6H,1-5H2,(H2,11,18)(H,13,19)(H3,12,14,15,16) |
| InChiKey: | InChIKey=BYFXIBUUZNYTHW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.