Molecular Structure:
CCD No.:CCD03391552
SELENA SEL10730629
Formula:C11 H15 N7 O
MolWeight:261.288
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10730629 |
| English Synonyms： | SELENA SEL10730629 |
| MDL Number.： | MFCD17125266 |
| H bond acceptor： | 8 |
| H bond donor： | 3 |
| Smile： | Cn1c2c(cn1)C(CCC2)NC(=O)c3nc([nH]n3)N |
| InChi： | InChI=1S/C11H15N7O/c1-18-8-4-2-3-7(6(8)5-13-18)14-10(19)9-15-11(12)17-16-9/h5,7H,2-4H2,1H3,(H,14,19)(H3,12,15,16,17) |
| InChiKey： | InChIKey=LNEGEQHMAKONTD-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
