* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10730630 |
English Synonyms: | SELENA SEL10730630 |
MDL Number.: | MFCD17125267 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | c1cc(c(cc1C(=O)O)NC(=O)c2nc([nH]n2)N)F |
InChi: | InChI=1S/C10H8FN5O3/c11-5-2-1-4(9(18)19)3-6(5)13-8(17)7-14-10(12)16-15-7/h1-3H,(H,13,17)(H,18,19)(H3,12,14,15,16) |
InChiKey: | InChIKey=FIURAHZHPBDGAO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.