Molecular Structure:
CCD No.:CCD03391562
SELENA SEL10730639
Formula:C9 H12 F3 N5 O
MolWeight:263.222
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10730639 |
| English Synonyms： | SELENA SEL10730639 |
| MDL Number.： | MFCD17125276 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | C1CC(CN(C1)C(=O)c2nc([nH]n2)N)C(F)(F)F |
| InChi： | InChI=1S/C9H12F3N5O/c10-9(11,12)5-2-1-3-17(4-5)7(18)6-14-8(13)16-15-6/h5H,1-4H2,(H3,13,14,15,16) |
| InChiKey： | InChIKey=IKDDOXYBKZDMDH-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
