Molecular Structure:
CCD No.:CCD03391572
SELENA SEL10730650
Formula:C9 H16 N6 O2
MolWeight:240.265
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10730650 |
| English Synonyms： | SELENA SEL10730650 |
| MDL Number.： | MFCD17125287 |
| H bond acceptor： | 8 |
| H bond donor： | 3 |
| Smile： | CCCNC(=O)CN(C)C(=O)c1nc([nH]n1)N |
| InChi： | InChI=1S/C9H16N6O2/c1-3-4-11-6(16)5-15(2)8(17)7-12-9(10)14-13-7/h3-5H2,1-2H3,(H,11,16)(H3,10,12,13,14) |
| InChiKey： | InChIKey=MFVGEIBVDNPBGN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
