* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10731092 |
English Synonyms: | SELENA SEL10731092 |
MDL Number.: | MFCD17125726 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | c1cc(c(cc1C(=O)O)NC(=O)c2csc(n2)N)F |
InChi: | InChI=1S/C11H8FN3O3S/c12-6-2-1-5(10(17)18)3-7(6)14-9(16)8-4-19-11(13)15-8/h1-4H,(H2,13,15)(H,14,16)(H,17,18) |
InChiKey: | InChIKey=CYWAVFQXZJUNGG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.