Molecular Structure:
CCD No.:CCD03392020
SELENA SEL10731104
Formula:C11 H12 N4 O2 S
MolWeight:264.308
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10731104 |
| English Synonyms： | SELENA SEL10731104 |
| MDL Number.： | MFCD17125738 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | CCn1cc(ccc1=O)NC(=O)c2csc(n2)N |
| InChi： | InChI=1S/C11H12N4O2S/c1-2-15-5-7(3-4-9(15)16)13-10(17)8-6-18-11(12)14-8/h3-6H,2H2,1H3,(H2,12,14)(H,13,17) |
| InChiKey： | InChIKey=VXDQEZJMKQTACX-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
