Molecular Structure:
CCD No.:CCD03393213
SELENA SEL10732426
Formula:C16 H22 N2 S
MolWeight:274.43
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10732426 |
| English Synonyms： | SELENA SEL10732426 |
| MDL Number.： | MFCD17126982 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | CCc1ccc(cc1)CC(Cc2nc(cs2)C)NC |
| InChi： | InChI=1S/C16H22N2S/c1-4-13-5-7-14(8-6-13)9-15(17-3)10-16-18-12(2)11-19-16/h5-8,11,15,17H,4,9-10H2,1-3H3 |
| InChiKey： | InChIKey=NWPFNXCARZMPNK-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
