Molecular Structure:
CCD No.:CCD03393216
SELENA SEL10732430
Formula:C12 H15 Cl N2 S2
MolWeight:286.849
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10732430 |
| English Synonyms： | SELENA SEL10732430 |
| MDL Number.： | MFCD17126986 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | Cc1csc(n1)CC(Cc2ccc(s2)Cl)NC |
| InChi： | InChI=1S/C12H15ClN2S2/c1-8-7-16-12(15-8)6-9(14-2)5-10-3-4-11(13)17-10/h3-4,7,9,14H,5-6H2,1-2H3 |
| InChiKey： | InChIKey=MFPGLZXVWBWPOL-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
