Molecular Structure:
CCD No.:CCD03393222
SELENA SEL10732438
Formula:C15 H20 N2 O S
MolWeight:276.402
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10732438 |
| English Synonyms： | SELENA SEL10732438 |
| MDL Number.： | MFCD17126994 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CCNC(Cc1nc(cs1)C)c2ccccc2OC |
| InChi： | InChI=1S/C15H20N2OS/c1-4-16-13(9-15-17-11(2)10-19-15)12-7-5-6-8-14(12)18-3/h5-8,10,13,16H,4,9H2,1-3H3 |
| InChiKey： | InChIKey=QLUUMUXKHDXOFB-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
