Molecular Structure:
CCD No.:CCD03393237
SELENA SEL10732455
Formula:C15 H19 F N2 S
MolWeight:278.393
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10732455 |
| English Synonyms： | SELENA SEL10732455 |
| MDL Number.： | MFCD17127011 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | CCCNC(Cc1nc(cs1)C)c2cccc(c2)F |
| InChi： | InChI=1S/C15H19FN2S/c1-3-7-17-14(9-15-18-11(2)10-19-15)12-5-4-6-13(16)8-12/h4-6,8,10,14,17H,3,7,9H2,1-2H3 |
| InChiKey： | InChIKey=KZJHUXQFQPCBNP-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
