Molecular Structure:
CCD No.:CCD03393252
SELENA SEL10732473
Formula:C12 H13 N3 O3 S
MolWeight:279.319
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10732473 |
| English Synonyms： | SELENA SEL10732473 |
| MDL Number.： | MFCD17127029 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | CCOC(=O)c1cnc([nH]c1=O)Cc2nc(cs2)C |
| InChi： | InChI=1S/C12H13N3O3S/c1-3-18-12(17)8-5-13-9(15-11(8)16)4-10-14-7(2)6-19-10/h5-6H,3-4H2,1-2H3,(H,13,15,16) |
| InChiKey： | InChIKey=XWLNQUDPVOTJIZ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
