Molecular Structure:
CCD No.:CCD03393284
SELENA SEL10732512
Formula:C16 H24 N2 O
MolWeight:260.379
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10732512 |
| English Synonyms： | SELENA SEL10732512 |
| MDL Number.： | MFCD17127061 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | Cn1cc(cn1)CC([C@@]23C[C@H]4C[C@@H](C2)C[C@H](C4)C3)O |
| InChi： | InChI=1S/C16H24N2O/c1-18-10-14(9-17-18)5-15(19)16-6-11-2-12(7-16)4-13(3-11)8-16/h9-13,15,19H,2-8H2,1H3/t11-,12+,13-,15?,16- |
| InChiKey： | InChIKey=KUHYNIZDHTYOGG-IBYIFTRZSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
