Molecular Structure:
CCD No.:CCD03393287
SELENA SEL10732520
Formula:C15 H19 N O S
MolWeight:261.387
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10732520 |
| English Synonyms： | SELENA SEL10732520 |
| MDL Number.： | MFCD17127065 |
| H bond acceptor： | 2 |
| H bond donor： | 0 |
| Smile： | CC(=O)c1cnc(s1)[C@@]23C[C@H]4C[C@@H](C2)C[C@H](C4)C3 |
| InChi： | InChI=1S/C15H19NOS/c1-9(17)13-8-16-14(18-13)15-5-10-2-11(6-15)4-12(3-10)7-15/h8,10-12H,2-7H2,1H3/t10-,11+,12-,15- |
| InChiKey： | InChIKey=SDEFQNRJSASTIE-WUQLGEGHSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
