* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10732527 |
| English Synonyms: | SELENA SEL10732527 |
| MDL Number.: | MFCD17127068 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCNc1nc(no1)[C@@]23C[C@H]4C[C@@H](C2)C[C@H](C4)C3 |
| InChi: | InChI=1S/C14H21N3O/c1-2-15-13-16-12(17-18-13)14-6-9-3-10(7-14)5-11(4-9)8-14/h9-11H,2-8H2,1H3,(H,15,16,17)/t9-,10+,11-,14- |
| InChiKey: | InChIKey=PLOSHHMRFFKFCV-UAMPICCDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.