* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6325204 |
English Synonyms: | ABAMACHEM ABA-6325204 |
MDL Number.: | MFCD17127116 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | CCCNC(=O)CNC(=O)Cc1csc(n1)N |
InChi: | InChI=1S/C10H16N4O2S/c1-2-3-12-9(16)5-13-8(15)4-7-6-17-10(11)14-7/h6H,2-5H2,1H3,(H2,11,14)(H,12,16)(H,13,15) |
InChiKey: | InChIKey=NJTVDOXQCVMTRI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.