* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10733253 |
English Synonyms: | SELENA SEL10733253 |
MDL Number.: | MFCD17127789 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | Cc1c(cc(o1)C(=O)O)S(=O)(=O)NCCS(=O)(=O)C |
InChi: | InChI=1S/C9H13NO7S2/c1-6-8(5-7(17-6)9(11)12)19(15,16)10-3-4-18(2,13)14/h5,10H,3-4H2,1-2H3,(H,11,12) |
InChiKey: | InChIKey=OIOVRFOWROOCGJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.