Molecular Structure:
CCD No.:CCD03393917
SELENA SEL10733257
Formula:C10 H14 N2 O6 S
MolWeight:290.295
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10733257 |
| English Synonyms： | SELENA SEL10733257 |
| MDL Number.： | MFCD17127793 |
| H bond acceptor： | 8 |
| H bond donor： | 3 |
| Smile： | Cc1c(cc(o1)C(=O)O)S(=O)(=O)NC(C)(C)C(=O)N |
| InChi： | InChI=1S/C10H14N2O6S/c1-5-7(4-6(18-5)8(13)14)19(16,17)12-10(2,3)9(11)15/h4,12H,1-3H3,(H2,11,15)(H,13,14) |
| InChiKey： | InChIKey=HNHZNXRGFXNQOG-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
