Molecular Structure:
CCD No.:CCD03393941
SELENA SEL10733281
Formula:C11 H14 Br N O5 S
MolWeight:352.204
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10733281 |
| English Synonyms： | SELENA SEL10733281 |
| MDL Number.： | MFCD17127817 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | CCN(CC(=C)C)S(=O)(=O)c1cc(oc1Br)C(=O)O |
| InChi： | InChI=1S/C11H14BrNO5S/c1-4-13(6-7(2)3)19(16,17)9-5-8(11(14)15)18-10(9)12/h5H,2,4,6H2,1,3H3,(H,14,15) |
| InChiKey： | InChIKey=FHXGLVQAYAGLQM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
