Molecular Structure:
CCD No.:CCD03393947
SELENA SEL10733287
Formula:C9 H11 Br N2 O6 S
MolWeight:355.164
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10733287 |
| English Synonyms： | SELENA SEL10733287 |
| MDL Number.： | MFCD17127823 |
| H bond acceptor： | 8 |
| H bond donor： | 2 |
| Smile： | CN(C)C(=O)CNS(=O)(=O)c1cc(oc1Br)C(=O)O |
| InChi： | InChI=1S/C9H11BrN2O6S/c1-12(2)7(13)4-11-19(16,17)6-3-5(9(14)15)18-8(6)10/h3,11H,4H2,1-2H3,(H,14,15) |
| InChiKey： | InChIKey=LNVWIQCBNNOVOO-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
