Molecular Structure:
CCD No.:CCD03394173
SELENA SEL10733580
Formula:C12 H14 Br N3 O
MolWeight:296.167
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10733580 |
| English Synonyms： | SELENA SEL10733580 |
| MDL Number.： | MFCD17128113 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CNCCc1nc(no1)Cc2ccccc2Br |
| InChi： | InChI=1S/C12H14BrN3O/c1-14-7-6-12-15-11(16-17-12)8-9-4-2-3-5-10(9)13/h2-5,14H,6-8H2,1H3 |
| InChiKey： | InChIKey=JUEXKUIEZHIXEU-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
